2-((3,4-Difluorophenoxy)methyl)pyrrolidine hydrochloride, 95%
cas: 1864064-90-3 — see every product listed under this CAS number, including other names
2-((3,4-Difluorophenoxy)methyl)pyrrolidine hydrochloride, 95% (CAS 1864064-90-3) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g. Offered by: Ambeed, BLDpharm, Chemat.
| brand | Ambeed |
|---|---|
| catalog number | A1077727-250mg |
| cas | 1864064-90-3 |
| size | 250mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 921.06 Pln | |
| Ambeed | 1g | 2367.31 Pln | |
| Ambeed | 5g | 6733.88 Pln | |
| BLDpharm | 250mg | 908.59 Pln | |
| BLDpharm | 1g | 2319.21 Pln | |
| BLDpharm | 5g | 6601.03 Pln | |
| Chemat | 250mg | 611.60 Pln | |
| Chemat | 1g | 1595.60 Pln | |
| Chemat | 5g | 6213.20 Pln |
properties
| purity | 95% |
|---|---|
| delivery time | 2-3 weeks |
2-[(3,4-difluorophenoxy)methyl]pyrrolidine;hydrochloride (CAS 1864064-90-3) is a chemical compound with the molecular formula C11H14ClF2NO and a molecular weight of 249.68 g/mol. IUPAC name: 2-[(3,4-difluorophenoxy)methyl]pyrrolidine;hydrochloride. InChIKey: FDYPGIQZVKRAOA-UHFFFAOYSA-N.
| Molecular formula | C11H14ClF2NO |
|---|---|
| Molecular weight | 249.68 g/mol |
| IUPAC name | 2-[(3,4-difluorophenoxy)methyl]pyrrolidine;hydrochloride |
| InChIKey | FDYPGIQZVKRAOA-UHFFFAOYSA-N |
| SMILES | C1CC(NC1)COC2=CC(=C(C=C2)F)F.Cl |
Computed by PubChem (NCBI)