Products 1628689-12-2
CAS 1628689-12-2 is the registry number for 4-(2,3-Difluorophenyl)piperidin-4-ol hydrochloride, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
4-(2,3-difluorophenyl)piperidin-4-ol;hydrochloride (CAS 1628689-12-2) is a chemical compound with the molecular formula C11H14ClF2NO and a molecular weight of 249.68 g/mol. IUPAC name: 4-(2,3-difluorophenyl)piperidin-4-ol;hydrochloride. InChIKey: XKUYTWPKFHUBQJ-UHFFFAOYSA-N.
| Molecular formula | C11H14ClF2NO |
|---|---|
| Molecular weight | 249.68 g/mol |
| IUPAC name | 4-(2,3-difluorophenyl)piperidin-4-ol;hydrochloride |
| InChIKey | XKUYTWPKFHUBQJ-UHFFFAOYSA-N |
| SMILES | C1CNCCC1(C2=C(C(=CC=C2)F)F)O.Cl |
Computed by PubChem (NCBI)