CAS 2832911-54-1 appears in our catalog under these names: 4-(2,4-Difluorophenyl)piperidin-4-ol hydrochloride, 95%, 4-(2,4-Difluorophenyl)piperidin-4-ol hydrochloride, 95%, 95%. Offered by: AmBeed, Chemat. Available pack sizes: 5g, 1g.
4-(2,4-difluorophenyl)piperidin-4-ol;hydrochloride (CAS 2832911-54-1) is a chemical compound with the molecular formula C11H14ClF2NO and a molecular weight of 249.68 g/mol. IUPAC name: 4-(2,4-difluorophenyl)piperidin-4-ol;hydrochloride. InChIKey: SEPNBEMKPRVYEJ-UHFFFAOYSA-N.
| Molecular formula | C11H14ClF2NO |
|---|---|
| Molecular weight | 249.68 g/mol |
| IUPAC name | 4-(2,4-difluorophenyl)piperidin-4-ol;hydrochloride |
| InChIKey | SEPNBEMKPRVYEJ-UHFFFAOYSA-N |
| SMILES | C1CNCCC1(C2=C(C=C(C=C2)F)F)O.Cl |
Computed by PubChem (NCBI)