CAS 1311314-39-2 is the registry number for 3-(4-(Difluoromethoxy)phenyl)cyclobutan-1-amine hydrochloride, 98%. Offered by: AmBeed. Available pack sizes: 1g.
3-[4-(difluoromethoxy)phenyl]cyclobutan-1-amine;hydrochloride (CAS 1311314-39-2) is a chemical compound with the molecular formula C11H14ClF2NO and a molecular weight of 249.68 g/mol. IUPAC name: 3-[4-(difluoromethoxy)phenyl]cyclobutan-1-amine;hydrochloride. InChIKey: BXKFOVHHKJUQNN-UHFFFAOYSA-N.
| Molecular formula | C11H14ClF2NO |
|---|---|
| Molecular weight | 249.68 g/mol |
| IUPAC name | 3-[4-(difluoromethoxy)phenyl]cyclobutan-1-amine;hydrochloride |
| InChIKey | BXKFOVHHKJUQNN-UHFFFAOYSA-N |
| SMILES | C1C(CC1N)C2=CC=C(C=C2)OC(F)F.Cl |
Computed by PubChem (NCBI)