CAS 1461704-73-3 is the registry number for 3-((2,5-Difluorophenyl)methoxy)cyclobutan-1-amine hydrochloride. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
3-[(2,5-difluorophenyl)methoxy]cyclobutan-1-amine;hydrochloride (CAS 1461704-73-3) is a chemical compound with the molecular formula C11H14ClF2NO and a molecular weight of 249.68 g/mol. IUPAC name: 3-[(2,5-difluorophenyl)methoxy]cyclobutan-1-amine;hydrochloride. InChIKey: WOMPQFIRUDXCEJ-UHFFFAOYSA-N.
| Molecular formula | C11H14ClF2NO |
|---|---|
| Molecular weight | 249.68 g/mol |
| IUPAC name | 3-[(2,5-difluorophenyl)methoxy]cyclobutan-1-amine;hydrochloride |
| InChIKey | WOMPQFIRUDXCEJ-UHFFFAOYSA-N |
| SMILES | C1C(CC1OCC2=C(C=CC(=C2)F)F)N.Cl |
Computed by PubChem (NCBI)