Products 2488794-53-0
CAS 2488794-53-0 is the registry number for 1-(4,4-Difluorochroman-8-yl)ethan-1-amine hydrochloride, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
1-(4,4-difluoro-2,3-dihydrochromen-8-yl)ethanamine;hydrochloride (CAS 2488794-53-0) is a chemical compound with the molecular formula C11H14ClF2NO and a molecular weight of 249.68 g/mol. IUPAC name: 1-(4,4-difluoro-2,3-dihydrochromen-8-yl)ethanamine;hydrochloride. InChIKey: QRSLFLXHKLPSGL-UHFFFAOYSA-N.
| Molecular formula | C11H14ClF2NO |
|---|---|
| Molecular weight | 249.68 g/mol |
| IUPAC name | 1-(4,4-difluoro-2,3-dihydrochromen-8-yl)ethanamine;hydrochloride |
| InChIKey | QRSLFLXHKLPSGL-UHFFFAOYSA-N |
| SMILES | CC(C1=C2C(=CC=C1)C(CCO2)(F)F)N.Cl |
Computed by PubChem (NCBI)