CAS 1354485-08-7 is the registry number for Rac-[(3s,4r)-4-(2,5-difluorophenyl)-3-pyrrolidinyl]methanol hydrochloride, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
[(3S,4R)-4-(2,5-difluorophenyl)pyrrolidin-3-yl]methanol;hydrochloride (CAS 1354485-08-7) is a chemical compound with the molecular formula C11H14ClF2NO and a molecular weight of 249.68 g/mol. IUPAC name: [(3S,4R)-4-(2,5-difluorophenyl)pyrrolidin-3-yl]methanol;hydrochloride. InChIKey: STPLOYFTJQWYIW-XQRIHRDZSA-N.
| Molecular formula | C11H14ClF2NO |
|---|---|
| Molecular weight | 249.68 g/mol |
| IUPAC name | [(3S,4R)-4-(2,5-difluorophenyl)pyrrolidin-3-yl]methanol;hydrochloride |
| InChIKey | STPLOYFTJQWYIW-XQRIHRDZSA-N |
| SMILES | C1[C@H]([C@@H](CN1)C2=C(C=CC(=C2)F)F)CO.Cl |
Computed by PubChem (NCBI)