Products 1864064-90-3
CAS 1864064-90-3 is the registry number for 2-((3,4-Difluorophenoxy)methyl)pyrrolidine hydrochloride, 95%. Offered by: Ambeed, BLDpharm, Chemat. Available pack sizes: 250mg, 1g, 5g.
2-[(3,4-difluorophenoxy)methyl]pyrrolidine;hydrochloride (CAS 1864064-90-3) is a chemical compound with the molecular formula C11H14ClF2NO and a molecular weight of 249.68 g/mol. IUPAC name: 2-[(3,4-difluorophenoxy)methyl]pyrrolidine;hydrochloride. InChIKey: FDYPGIQZVKRAOA-UHFFFAOYSA-N.
| Molecular formula | C11H14ClF2NO |
|---|---|
| Molecular weight | 249.68 g/mol |
| IUPAC name | 2-[(3,4-difluorophenoxy)methyl]pyrrolidine;hydrochloride |
| InChIKey | FDYPGIQZVKRAOA-UHFFFAOYSA-N |
| SMILES | C1CC(NC1)COC2=CC(=C(C=C2)F)F.Cl |
Computed by PubChem (NCBI)