cas: 82651-72-7 — see every product listed under this CAS number, including other names
2-((Phenylsulfonyl)methyl)benzonitrile, 98% (CAS 82651-72-7) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 10g, 1g, 5g. Offered by: AmBeed, Fluorochem.
| brand | AmBeed |
|---|---|
| catalog number | A856420-250mg |
| cas | 82651-72-7 |
| size | 250mg |
| availability | Synthetic Items: 0g |
| brand | size | price | |
|---|---|---|---|
| AmBeed | 250mg | 486.64 Pln | |
| AmBeed | 10g | 3793.72 Pln | |
| Fluorochem | 1g | 372.80 Pln | |
| Fluorochem | 5g | 1419.31 Pln |
| purity | 98% |
|---|---|
| delivery time | To be confirmed by Chemat |
2-(benzenesulfonylmethyl)benzonitrile (CAS 82651-72-7) is a chemical compound with the molecular formula C14H11NO2S and a molecular weight of 257.31 g/mol. IUPAC name: 2-(benzenesulfonylmethyl)benzonitrile. InChIKey: MDVRSLRSVHAHNX-UHFFFAOYSA-N.
| Molecular formula | C14H11NO2S |
|---|---|
| Molecular weight | 257.31 g/mol |
| IUPAC name | 2-(benzenesulfonylmethyl)benzonitrile |
| InChIKey | MDVRSLRSVHAHNX-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)S(=O)(=O)CC2=CC=CC=C2C#N |
Computed by PubChem (NCBI)