Products 80066-96-2
CAS 80066-96-2 is the registry number for methyl 3-(1H-pyrrol-1-yl)-1-benzothiophene-2-carboxylate. Offered by: Fluorochem. Available pack sizes: 1g, 5g.
Methyl 3-pyrrol-1-yl-1-benzothiophene-2-carboxylate (CAS 80066-96-2) is a chemical compound with the molecular formula C14H11NO2S and a molecular weight of 257.31 g/mol. IUPAC name: methyl 3-pyrrol-1-yl-1-benzothiophene-2-carboxylate. InChIKey: PYHLVVUFCLPJGY-UHFFFAOYSA-N.
| Molecular formula | C14H11NO2S |
|---|---|
| Molecular weight | 257.31 g/mol |
| IUPAC name | methyl 3-pyrrol-1-yl-1-benzothiophene-2-carboxylate |
| InChIKey | PYHLVVUFCLPJGY-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=C(C2=CC=CC=C2S1)N3C=CC=C3 |
Computed by PubChem (NCBI)