Products 25244-68-2
CAS 25244-68-2 appears in our catalog under these names: 2–(10H–Phenothiazin–10–yl)acetic acid, 2-(10H-Phenothiazin-10-yl)acetic acid, 2-(10H-Phenothiazin-10-yl)acetic acid, 95+%, Phenothiazine-10-acetic acid, 95%, 2-(10H-Phenothiazin-10-yl)acetic acid, 95+%, 95+%. Offered by: GLPBio, Biosynth, AmBeed, Fluorochem, Combi-blocks. Available pack sizes: 1g, 100mg, 5g, 250mg, 500mg, 50mg, 10g.
2-phenothiazin-10-ylacetic acid (CAS 25244-68-2) is a chemical compound with the molecular formula C14H11NO2S and a molecular weight of 257.31 g/mol. IUPAC name: 2-phenothiazin-10-ylacetic acid. InChIKey: QUJVFIOYSMVYGY-UHFFFAOYSA-N.
| Molecular formula | C14H11NO2S |
|---|---|
| Molecular weight | 257.31 g/mol |
| IUPAC name | 2-phenothiazin-10-ylacetic acid |
| InChIKey | QUJVFIOYSMVYGY-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)N(C3=CC=CC=C3S2)CC(=O)O |
Computed by PubChem (NCBI)