CAS 1217-37-4 is the registry number for Promethazine Impurity 2. Offered by: Chemat Brand. Available pack sizes: on request.
1-(5-oxophenothiazin-10-yl)ethanone (CAS 1217-37-4) is a chemical compound with the molecular formula C14H11NO2S and a molecular weight of 257.31 g/mol. IUPAC name: 1-(5-oxophenothiazin-10-yl)ethanone. InChIKey: SZLYHEJOJMRRFR-UHFFFAOYSA-N.
| Molecular formula | C14H11NO2S |
|---|---|
| Molecular weight | 257.31 g/mol |
| IUPAC name | 1-(5-oxophenothiazin-10-yl)ethanone |
| InChIKey | SZLYHEJOJMRRFR-UHFFFAOYSA-N |
| SMILES | CC(=O)N1C2=CC=CC=C2S(=O)C3=CC=CC=C31 |
Computed by PubChem (NCBI)