Products 450376-01-9
CAS 450376-01-9 is the registry number for N-(Benzo(d)(1,3)dioxol-5-yl)benzothioamide, 95-<97%. Offered by: Hoffman Fine Chemicals. Available pack sizes: 1g, 2,5g, 5g, 10g, 25g.
N-(1,3-benzodioxol-5-yl)benzenecarbothioamide (CAS 450376-01-9) is a chemical compound with the molecular formula C14H11NO2S and a molecular weight of 257.31 g/mol. IUPAC name: N-(1,3-benzodioxol-5-yl)benzenecarbothioamide. InChIKey: DXJOFXXXQWOXHH-UHFFFAOYSA-N.
| Molecular formula | C14H11NO2S |
|---|---|
| Molecular weight | 257.31 g/mol |
| IUPAC name | N-(1,3-benzodioxol-5-yl)benzenecarbothioamide |
| InChIKey | DXJOFXXXQWOXHH-UHFFFAOYSA-N |
| SMILES | C1OC2=C(O1)C=C(C=C2)NC(=S)C3=CC=CC=C3 |
Computed by PubChem (NCBI)