CAS 90481-46-2 is the registry number for 2-(2-Benzothiazolyl)-5-methoxyphenol, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg.
2-(1,3-benzothiazol-2-yl)-5-methoxyphenol (CAS 90481-46-2) is a chemical compound with the molecular formula C14H11NO2S and a molecular weight of 257.31 g/mol. IUPAC name: 2-(1,3-benzothiazol-2-yl)-5-methoxyphenol. InChIKey: KQUJPMLQKNTPCL-UHFFFAOYSA-N.
| Molecular formula | C14H11NO2S |
|---|---|
| Molecular weight | 257.31 g/mol |
| IUPAC name | 2-(1,3-benzothiazol-2-yl)-5-methoxyphenol |
| InChIKey | KQUJPMLQKNTPCL-UHFFFAOYSA-N |
| SMILES | COC1=CC(=C(C=C1)C2=NC3=CC=CC=C3S2)O |
Computed by PubChem (NCBI)