Products 148682-16-0
CAS 148682-16-0 is the registry number for Ethyl 5-(4-cyanophenyl)thiophene-2-carboxylate, 95-<97%. Offered by: Hoffman Fine Chemicals. Available pack sizes: 500mg, 1g, 2,5g, 5g, 10g.
Ethyl 5-(4-cyanophenyl)thiophene-2-carboxylate (CAS 148682-16-0) is a chemical compound with the molecular formula C14H11NO2S and a molecular weight of 257.31 g/mol. IUPAC name: ethyl 5-(4-cyanophenyl)thiophene-2-carboxylate. InChIKey: CVEJCPKPKJYTOS-UHFFFAOYSA-N.
| Molecular formula | C14H11NO2S |
|---|---|
| Molecular weight | 257.31 g/mol |
| IUPAC name | ethyl 5-(4-cyanophenyl)thiophene-2-carboxylate |
| InChIKey | CVEJCPKPKJYTOS-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=CC=C(S1)C2=CC=C(C=C2)C#N |
Computed by PubChem (NCBI)