CAS 29948-26-3 is the registry number for Ethyl thieno[3,2-f]quinoline-2-carboxylate, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 100mg, 250mg.
Ethyl thieno[3,2-f]quinoline-2-carboxylate (CAS 29948-26-3) is a chemical compound with the molecular formula C14H11NO2S and a molecular weight of 257.31 g/mol. IUPAC name: ethyl thieno[3,2-f]quinoline-2-carboxylate. InChIKey: UYYKQIBHCFTHOQ-UHFFFAOYSA-N.
| Molecular formula | C14H11NO2S |
|---|---|
| Molecular weight | 257.31 g/mol |
| IUPAC name | ethyl thieno[3,2-f]quinoline-2-carboxylate |
| InChIKey | UYYKQIBHCFTHOQ-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=CC2=C(S1)C=CC3=C2C=CC=N3 |
Computed by PubChem (NCBI)