cas: 25244-68-2 — see every product listed under this CAS number, including other names
2-(10H-Phenothiazin-10-yl)acetic acid, 95+%, 95+% (CAS 25244-68-2) is a chemical reagent available from Chemat. Available pack sizes: 50mg, 100mg, 250mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch117WOD-50mg |
| cas | 25244-68-2 |
| size | 50mg |
| availability | 5g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 50mg | 410.00 Pln | |
| Chemat | 100mg | 640.40 Pln | |
| Chemat | 250mg | 1230.80 Pln | |
| Chemat | 1g | 3002.00 Pln |
| purity | 95+% |
|---|---|
| delivery time | 3 weeks |
2-phenothiazin-10-ylacetic acid (CAS 25244-68-2) is a chemical compound with the molecular formula C14H11NO2S and a molecular weight of 257.31 g/mol. IUPAC name: 2-phenothiazin-10-ylacetic acid. InChIKey: QUJVFIOYSMVYGY-UHFFFAOYSA-N.
| Molecular formula | C14H11NO2S |
|---|---|
| Molecular weight | 257.31 g/mol |
| IUPAC name | 2-phenothiazin-10-ylacetic acid |
| InChIKey | QUJVFIOYSMVYGY-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)N(C3=CC=CC=C3S2)CC(=O)O |
Computed by PubChem (NCBI)