cas: 141428-47-9 — see every product listed under this CAS number, including other names
2-(2,3-Difluoro-6-nitrophenyl)acetic acid, 98% (CAS 141428-47-9) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F227967-250MG |
| cas | 141428-47-9 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 250mg | 279.09 Pln | |
| Fluorochem | 1g | 289.50 Pln | |
| Fluorochem | 5g | 716.43 Pln |
| purity | 98% |
|---|---|
| delivery time | 3-4 weeks |
2-(2,3-difluoro-6-nitrophenyl)acetic acid (CAS 141428-47-9) is a chemical compound with the molecular formula C8H5F2NO4 and a molecular weight of 217.13 g/mol. IUPAC name: 2-(2,3-difluoro-6-nitrophenyl)acetic acid. InChIKey: KZNVCGPCWKYPKD-UHFFFAOYSA-N.
| Molecular formula | C8H5F2NO4 |
|---|---|
| Molecular weight | 217.13 g/mol |
| IUPAC name | 2-(2,3-difluoro-6-nitrophenyl)acetic acid |
| InChIKey | KZNVCGPCWKYPKD-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1[N+](=O)[O-])CC(=O)O)F)F |
Computed by PubChem (NCBI)