cas: 141428-47-9 — see every product listed under this CAS number, including other names
2-(2,3-Difluoro-6-nitrophenyl)acetic acid, 98%, 98% (CAS 141428-47-9) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch112GCZ-100mg |
| cas | 141428-47-9 |
| size | 100mg |
| availability | 20g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 136.40 Pln | |
| Chemat | 250mg | 179.60 Pln | |
| Chemat | 1g | 246.80 Pln | |
| Chemat | 5g | 573.20 Pln | |
| Chemat | 10g | 995.60 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
2-(2,3-difluoro-6-nitrophenyl)acetic acid (CAS 141428-47-9) is a chemical compound with the molecular formula C8H5F2NO4 and a molecular weight of 217.13 g/mol. IUPAC name: 2-(2,3-difluoro-6-nitrophenyl)acetic acid. InChIKey: KZNVCGPCWKYPKD-UHFFFAOYSA-N.
| Molecular formula | C8H5F2NO4 |
|---|---|
| Molecular weight | 217.13 g/mol |
| IUPAC name | 2-(2,3-difluoro-6-nitrophenyl)acetic acid |
| InChIKey | KZNVCGPCWKYPKD-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1[N+](=O)[O-])CC(=O)O)F)F |
Computed by PubChem (NCBI)