cas: 141428-47-9 — see every product listed under this CAS number, including other names
2,3-Difluoro-6-nitrophenylacetic Acid, >98.0%(GC)(T) (CAS 141428-47-9) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g. Offered by: TCI.
| brand | TCI |
|---|---|
| catalog number | D4583-1G |
| cas | 141428-47-9 |
| size | 1g |
| availability | 2 tygodnie|2 weeks |
| brand | size | price | |
|---|---|---|---|
| TCI | 1g | 246.19 Pln | |
| TCI | 5g | 796.93 Pln |
| delivery time | 2 weeks |
|---|---|
| category | chemicals |
| purity | >98.0%(GC)(T) |
2-(2,3-difluoro-6-nitrophenyl)acetic acid (CAS 141428-47-9) is a chemical compound with the molecular formula C8H5F2NO4 and a molecular weight of 217.13 g/mol. IUPAC name: 2-(2,3-difluoro-6-nitrophenyl)acetic acid. InChIKey: KZNVCGPCWKYPKD-UHFFFAOYSA-N.
| Molecular formula | C8H5F2NO4 |
|---|---|
| Molecular weight | 217.13 g/mol |
| IUPAC name | 2-(2,3-difluoro-6-nitrophenyl)acetic acid |
| InChIKey | KZNVCGPCWKYPKD-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1[N+](=O)[O-])CC(=O)O)F)F |
Computed by PubChem (NCBI)