cas: 302912-02-3 — see every product listed under this CAS number, including other names
2-(2,5-Bis(trifluoromethyl)phenyl)acetic acid, 98%, 98% (CAS 302912-02-3) is a chemical reagent available from Chemat. Available pack sizes: 100mg. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch113ZHF-100mg |
| cas | 302912-02-3 |
| size | 100mg |
| availability | 0.2g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 266.00 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
2-[2,5-bis(trifluoromethyl)phenyl]acetic acid (CAS 302912-02-3) is a chemical compound with the molecular formula C10H6F6O2 and a molecular weight of 272.14 g/mol. IUPAC name: 2-[2,5-bis(trifluoromethyl)phenyl]acetic acid. InChIKey: AWTNYFICBCCTBY-UHFFFAOYSA-N.
| Molecular formula | C10H6F6O2 |
|---|---|
| Molecular weight | 272.14 g/mol |
| IUPAC name | 2-[2,5-bis(trifluoromethyl)phenyl]acetic acid |
| InChIKey | AWTNYFICBCCTBY-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1C(F)(F)F)CC(=O)O)C(F)(F)F |
Computed by PubChem (NCBI)