cas: 582-54-7 — see every product listed under this CAS number, including other names
2-(2,5-Dichlorophenoxy)acetic acid, 95%, 95% (CAS 582-54-7) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11EEBK-100mg |
| cas | 582-54-7 |
| size | 100mg |
| availability | 25g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 290.00 Pln | |
| Chemat | 250mg | 386.00 Pln | |
| Chemat | 1g | 707.60 Pln | |
| Chemat | 5g | 1706.00 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
2-(2,5-dichlorophenoxy)acetic acid (CAS 582-54-7) is a chemical compound with the molecular formula C8H6Cl2O3 and a molecular weight of 221.03 g/mol. IUPAC name: 2-(2,5-dichlorophenoxy)acetic acid. InChIKey: YVPLLFUCNGVUAY-UHFFFAOYSA-N.
| Molecular formula | C8H6Cl2O3 |
|---|---|
| Molecular weight | 221.03 g/mol |
| IUPAC name | 2-(2,5-dichlorophenoxy)acetic acid |
| InChIKey | YVPLLFUCNGVUAY-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1Cl)OCC(=O)O)Cl |
Computed by PubChem (NCBI)