Products 35599-94-1
CAS 35599-94-1 appears in our catalog under these names: 2-(3,5-Dichlorophenyl)-2-hydroxyacetic acid, 95%, 2-(3,5-Dichlorophenyl)-2-hydroxyacetic acid. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 1g, 250mg, 5g, 100mg.
2-(3,5-dichlorophenyl)-2-hydroxyacetic acid (CAS 35599-94-1) is a chemical compound with the molecular formula C8H6Cl2O3 and a molecular weight of 221.03 g/mol. IUPAC name: 2-(3,5-dichlorophenyl)-2-hydroxyacetic acid. InChIKey: MIEFWJKVKNYRRC-UHFFFAOYSA-N.
| Molecular formula | C8H6Cl2O3 |
|---|---|
| Molecular weight | 221.03 g/mol |
| IUPAC name | 2-(3,5-dichlorophenyl)-2-hydroxyacetic acid |
| InChIKey | MIEFWJKVKNYRRC-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C=C1Cl)Cl)C(C(=O)O)O |
Computed by PubChem (NCBI)