Products 115382-33-7

CAS 115382-33-7 is the registry number for 2,4-Dichloro-3-methoxybenzoic acid, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 5g, 250mg.

Structural formula: {0} (CAS {1})

2,4-dichloro-3-methoxybenzoic acid (CAS 115382-33-7) is a chemical compound with the molecular formula C8H6Cl2O3 and a molecular weight of 221.03 g/mol. IUPAC name: 2,4-dichloro-3-methoxybenzoic acid. InChIKey: MMAQCSXFBGMUFH-UHFFFAOYSA-N.

Identity
Molecular formulaC8H6Cl2O3
Molecular weight221.03 g/mol
IUPAC name2,4-dichloro-3-methoxybenzoic acid
InChIKeyMMAQCSXFBGMUFH-UHFFFAOYSA-N
SMILESCOC1=C(C=CC(=C1Cl)C(=O)O)Cl

Computed by PubChem (NCBI)