cas: 25563-04-6 — see every product listed under this CAS number, including other names
2-(2-(4-Chlorophenoxy)phenyl)acetic acid 95% (CAS 25563-04-6) is a chemical reagent available from Chemat. Available pack sizes: 50mg, 100mg, 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A182831-50mg |
| cas | 25563-04-6 |
| size | 50mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 50mg | 181.25 Pln | |
| Ambeed | 100mg | 203.50 Pln | |
| Ambeed | 250mg | 270.25 Pln | |
| Ambeed | 1g | 498.31 Pln | |
| Ambeed | 5g | 1354.94 Pln |
| purity | 95% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A182831 |
2-[2-(4-chlorophenoxy)phenyl]acetic acid (CAS 25563-04-6) is a chemical compound with the molecular formula C14H11ClO3 and a molecular weight of 262.69 g/mol. IUPAC name: 2-[2-(4-chlorophenoxy)phenyl]acetic acid. InChIKey: ALMJMOPIBISVHZ-UHFFFAOYSA-N.
| Molecular formula | C14H11ClO3 |
|---|---|
| Molecular weight | 262.69 g/mol |
| IUPAC name | 2-[2-(4-chlorophenoxy)phenyl]acetic acid |
| InChIKey | ALMJMOPIBISVHZ-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)CC(=O)O)OC2=CC=C(C=C2)Cl |
Computed by PubChem (NCBI)