2-(2-(Difluoromethoxy)phenyl)-2-hydroxyacetic acid, 95%
cas: 1214384-68-5 — see every product listed under this CAS number, including other names
2-(2-(Difluoromethoxy)phenyl)-2-hydroxyacetic acid, 95% (CAS 1214384-68-5) is a chemical reagent available from Chemat. Available pack sizes: 50mg, 100mg, 250mg, 500mg, 1g, 2.5g, 5g. Offered by: Fluorochem, Chemat.
| brand | Fluorochem |
|---|---|
| catalog number | F746127-50MG |
| cas | 1214384-68-5 |
| size | 50mg |
| availability | In Stock China |
Documents:
Safety Data Sheet (MSDS)
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 50mg | 1054.85 Pln | |
| Fluorochem | 100mg | 1445.34 Pln | |
| Fluorochem | 250mg | 2356.48 Pln | |
| Fluorochem | 500mg | 2986.47 Pln | |
| Fluorochem | 1g | 3111.42 Pln | |
| Fluorochem | 2.5g | 5964.58 Pln | |
| Fluorochem | 5g | 10723.33 Pln | |
| Chemat | 50mg | 597.20 Pln | |
| Chemat | 100mg | 842.00 Pln | |
| Chemat | 250mg | 1466.00 Pln | |
| Chemat | 1g | 3712.40 Pln | |
| Chemat | 5g | 11138.00 Pln |
properties
| purity | 95% |
|---|---|
| dual use | No |
| currency | EUR |
| delivery time | 2-3 weeks |
| category | Odczynniki chemiczne |
2-[2-(difluoromethoxy)phenyl]-2-hydroxyacetic acid (CAS 1214384-68-5) is a chemical compound with the molecular formula C9H8F2O4 and a molecular weight of 218.15 g/mol. IUPAC name: 2-[2-(difluoromethoxy)phenyl]-2-hydroxyacetic acid. InChIKey: MCWJRNAZWINLDU-UHFFFAOYSA-N.
| Molecular formula | C9H8F2O4 |
|---|---|
| Molecular weight | 218.15 g/mol |
| IUPAC name | 2-[2-(difluoromethoxy)phenyl]-2-hydroxyacetic acid |
| InChIKey | MCWJRNAZWINLDU-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)C(C(=O)O)O)OC(F)F |
Computed by PubChem (NCBI)