cas: 1266253-67-1 — see every product listed under this CAS number, including other names
2-(2-Bromo-4,5-difluorophenoxy)propane (CAS 1266253-67-1) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F632541-1G |
| cas | 1266253-67-1 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 919.49 Pln | |
| Fluorochem | 5g | 2632.42 Pln |
| delivery time | 3-4 weeks |
|---|
1-bromo-4,5-difluoro-2-propan-2-yloxybenzene (CAS 1266253-67-1) is a chemical compound with the molecular formula C9H9BrF2O and a molecular weight of 251.07 g/mol. IUPAC name: 1-bromo-4,5-difluoro-2-propan-2-yloxybenzene. InChIKey: CLWBEPLRAXFDCZ-UHFFFAOYSA-N.
| Molecular formula | C9H9BrF2O |
|---|---|
| Molecular weight | 251.07 g/mol |
| IUPAC name | 1-bromo-4,5-difluoro-2-propan-2-yloxybenzene |
| InChIKey | CLWBEPLRAXFDCZ-UHFFFAOYSA-N |
| SMILES | CC(C)OC1=CC(=C(C=C1Br)F)F |
Computed by PubChem (NCBI)