CAS 181806-55-3 is the registry number for 4-Ethoxy-2,3-difluorobenzyl bromide, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
1-(bromomethyl)-4-ethoxy-2,3-difluorobenzene (CAS 181806-55-3) is a chemical compound with the molecular formula C9H9BrF2O and a molecular weight of 251.07 g/mol. IUPAC name: 1-(bromomethyl)-4-ethoxy-2,3-difluorobenzene. InChIKey: UDFOEUCJEQEAMK-UHFFFAOYSA-N.
| Molecular formula | C9H9BrF2O |
|---|---|
| Molecular weight | 251.07 g/mol |
| IUPAC name | 1-(bromomethyl)-4-ethoxy-2,3-difluorobenzene |
| InChIKey | UDFOEUCJEQEAMK-UHFFFAOYSA-N |
| SMILES | CCOC1=C(C(=C(C=C1)CBr)F)F |
Computed by PubChem (NCBI)