CAS 1706430-78-5 appears in our catalog under these names: 2,3-Difluoro-5-methoxy-4-methylbenzyl bromide, 95%, 1-(Bromomethyl)-2,3-difluoro-5-methoxy-4-methylbenzene, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 250mg, 1g.
1-(bromomethyl)-2,3-difluoro-5-methoxy-4-methylbenzene (CAS 1706430-78-5) is a chemical compound with the molecular formula C9H9BrF2O and a molecular weight of 251.07 g/mol. IUPAC name: 1-(bromomethyl)-2,3-difluoro-5-methoxy-4-methylbenzene. InChIKey: LQHQSYCZWCWFFS-UHFFFAOYSA-N.
| Molecular formula | C9H9BrF2O |
|---|---|
| Molecular weight | 251.07 g/mol |
| IUPAC name | 1-(bromomethyl)-2,3-difluoro-5-methoxy-4-methylbenzene |
| InChIKey | LQHQSYCZWCWFFS-UHFFFAOYSA-N |
| SMILES | CC1=C(C=C(C(=C1F)F)CBr)OC |
Computed by PubChem (NCBI)