CAS 1339508-59-6 is the registry number for 4-Bromo-1-(2,2-difluoroethoxy)-2-methylbenzene, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 250mg, 1g.
4-bromo-1-(2,2-difluoroethoxy)-2-methylbenzene (CAS 1339508-59-6) is a chemical compound with the molecular formula C9H9BrF2O and a molecular weight of 251.07 g/mol. IUPAC name: 4-bromo-1-(2,2-difluoroethoxy)-2-methylbenzene. InChIKey: OBKKOBLLZDNYCJ-UHFFFAOYSA-N.
| Molecular formula | C9H9BrF2O |
|---|---|
| Molecular weight | 251.07 g/mol |
| IUPAC name | 4-bromo-1-(2,2-difluoroethoxy)-2-methylbenzene |
| InChIKey | OBKKOBLLZDNYCJ-UHFFFAOYSA-N |
| SMILES | CC1=C(C=CC(=C1)Br)OCC(F)F |
Computed by PubChem (NCBI)