CAS 864054-55-7 is the registry number for 3-(2,2-Difluoroethoxy)benzyl bromide, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 5g, 1g.
1-(bromomethyl)-3-(2,2-difluoroethoxy)benzene (CAS 864054-55-7) is a chemical compound with the molecular formula C9H9BrF2O and a molecular weight of 251.07 g/mol. IUPAC name: 1-(bromomethyl)-3-(2,2-difluoroethoxy)benzene. InChIKey: HWEFIVWMYFGOBQ-UHFFFAOYSA-N.
| Molecular formula | C9H9BrF2O |
|---|---|
| Molecular weight | 251.07 g/mol |
| IUPAC name | 1-(bromomethyl)-3-(2,2-difluoroethoxy)benzene |
| InChIKey | HWEFIVWMYFGOBQ-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)OCC(F)F)CBr |
Computed by PubChem (NCBI)