Products 1017779-51-9
CAS 1017779-51-9 appears in our catalog under these names: 2-(Bromomethyl)-5-ethoxy-1,3-difluorobenzene, 95%, 2-(Bromomethyl)-5-ethoxy-1,3-difluorobenzene 98%, 2-(Bromomethyl)-5-ethoxy-1,3-difluorobenzene. Offered by: Combi-blocks, Ambeed, Fluorochem. Available pack sizes: 1g, 5g, 25g, 250mg.
2-(bromomethyl)-5-ethoxy-1,3-difluorobenzene (CAS 1017779-51-9) is a chemical compound with the molecular formula C9H9BrF2O and a molecular weight of 251.07 g/mol. IUPAC name: 2-(bromomethyl)-5-ethoxy-1,3-difluorobenzene. InChIKey: FLUSMXIXICUDDW-UHFFFAOYSA-N.
| Molecular formula | C9H9BrF2O |
|---|---|
| Molecular weight | 251.07 g/mol |
| IUPAC name | 2-(bromomethyl)-5-ethoxy-1,3-difluorobenzene |
| InChIKey | FLUSMXIXICUDDW-UHFFFAOYSA-N |
| SMILES | CCOC1=CC(=C(C(=C1)F)CBr)F |
Computed by PubChem (NCBI)