CAS 1242070-97-8 is the registry number for 1-Bromo-3,4-difluoro-2-isopropoxybenzene, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 10g, 25g, 1g, 250mg.
1-bromo-3,4-difluoro-2-propan-2-yloxybenzene (CAS 1242070-97-8) is a chemical compound with the molecular formula C9H9BrF2O and a molecular weight of 251.07 g/mol. IUPAC name: 1-bromo-3,4-difluoro-2-propan-2-yloxybenzene. InChIKey: KPOMDAQNELQWAQ-UHFFFAOYSA-N.
| Molecular formula | C9H9BrF2O |
|---|---|
| Molecular weight | 251.07 g/mol |
| IUPAC name | 1-bromo-3,4-difluoro-2-propan-2-yloxybenzene |
| InChIKey | KPOMDAQNELQWAQ-UHFFFAOYSA-N |
| SMILES | CC(C)OC1=C(C=CC(=C1F)F)Br |
Computed by PubChem (NCBI)