CAS 2121514-69-8 appears in our catalog under these names: 5-Bromo-1,4-difluoro-2-isopropoxybenzene, 95%, 5-Bromo-1,4-difluoro-2-isopropoxybenzene. Offered by: Combi-blocks, Fluorochem. Available pack sizes: 10g, 25g, 100g, 5g, 1g.
1-bromo-2,5-difluoro-4-propan-2-yloxybenzene (CAS 2121514-69-8) is a chemical compound with the molecular formula C9H9BrF2O and a molecular weight of 251.07 g/mol. IUPAC name: 1-bromo-2,5-difluoro-4-propan-2-yloxybenzene. InChIKey: HZLXOZDSEZJIOK-UHFFFAOYSA-N.
| Molecular formula | C9H9BrF2O |
|---|---|
| Molecular weight | 251.07 g/mol |
| IUPAC name | 1-bromo-2,5-difluoro-4-propan-2-yloxybenzene |
| InChIKey | HZLXOZDSEZJIOK-UHFFFAOYSA-N |
| SMILES | CC(C)OC1=CC(=C(C=C1F)Br)F |
Computed by PubChem (NCBI)