cas: 215797-66-3 — see every product listed under this CAS number, including other names
2-(2-TRIFLUOROMETHYL-PHENYL)-ETHYLAMINE HYDROCHLORIDE, 95%, 95% (CAS 215797-66-3) is a chemical reagent available from Chemat. Available pack sizes: 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11BBLT-1g |
| cas | 215797-66-3 |
| size | 1g |
| availability | 4.75g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 1g | 150.80 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
2-[2-(trifluoromethyl)phenyl]ethanamine;hydrochloride (CAS 215797-66-3) is a chemical compound with the molecular formula C9H11ClF3N and a molecular weight of 225.64 g/mol. IUPAC name: 2-[2-(trifluoromethyl)phenyl]ethanamine;hydrochloride. InChIKey: VHZOEQDGCJAKDR-UHFFFAOYSA-N.
| Molecular formula | C9H11ClF3N |
|---|---|
| Molecular weight | 225.64 g/mol |
| IUPAC name | 2-[2-(trifluoromethyl)phenyl]ethanamine;hydrochloride |
| InChIKey | VHZOEQDGCJAKDR-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)CCN)C(F)(F)F.Cl |
Computed by PubChem (NCBI)