cas: 588-22-7 — see every product listed under this CAS number, including other names
2-(3,4-Dichlorophenoxy)acetic acid, 98% (CAS 588-22-7) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g, 25g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F607917-250MG |
| cas | 588-22-7 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 250mg | 91.65 Pln | |
| Fluorochem | 1g | 122.89 Pln | |
| Fluorochem | 5g | 357.18 Pln | |
| Fluorochem | 10g | 560.24 Pln | |
| Fluorochem | 25g | 1049.65 Pln |
| purity | 98% |
|---|---|
| delivery time | 3-4 weeks |
3,4-dichlorophenoxyacetic acid is a chlorophenoxyacetic acid that is phenoxyacetic acid in which the hydrogens at positions 3 and 4 of the phenyl group are replaced by chlorines. It has a role as a phenoxy herbicide.
Source: ChEBI
| Molecular formula | C8H6Cl2O3 |
|---|---|
| Molecular weight | 221.03 g/mol |
| IUPAC name | 2-(3,4-dichlorophenoxy)acetic acid |
| InChIKey | SNYRXHULAWEECU-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1OCC(=O)O)Cl)Cl |
Computed by PubChem (NCBI)