2-(3,5-Difluorophenoxy)acetic acid, 97%, 97%
cas: 370-02-5 — see every product listed under this CAS number, including other names
2-(3,5-Difluorophenoxy)acetic acid, 97%, 97% (CAS 370-02-5) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 50mg, 100mg, 500mg. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch12BBXT-250mg |
| cas | 370-02-5 |
| size | 250mg |
| availability | 1g |
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Chemat | 250mg | 832.40 Pln | |
| Chemat | 50mg | 424.40 Pln | |
| Chemat | 100mg | 597.20 Pln | |
| Chemat | 500mg | 1274.00 Pln |
properties
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
2-(3,5-difluorophenoxy)acetic acid (CAS 370-02-5) is a chemical compound with the molecular formula C8H6F2O3 and a molecular weight of 188.13 g/mol. IUPAC name: 2-(3,5-difluorophenoxy)acetic acid. InChIKey: DAKQOKIYIPBOHY-UHFFFAOYSA-N.
| Molecular formula | C8H6F2O3 |
|---|---|
| Molecular weight | 188.13 g/mol |
| IUPAC name | 2-(3,5-difluorophenoxy)acetic acid |
| InChIKey | DAKQOKIYIPBOHY-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C=C1F)F)OCC(=O)O |
Computed by PubChem (NCBI)