2-(3,5-Difluorophenoxy)acetic acid, 97%
cas: 370-02-5 — see every product listed under this CAS number, including other names
2-(3,5-Difluorophenoxy)acetic acid, 97% (CAS 370-02-5) is a chemical reagent available from Chemat. Available pack sizes: 50mg, 100mg, 250mg, 500mg, 1g, 2.5g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F656579-50MG |
| cas | 370-02-5 |
| size | 50mg |
Documents:
Safety Data Sheet (MSDS)
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 50mg | 529.00 Pln | |
| Fluorochem | 100mg | 758.08 Pln | |
| Fluorochem | 250mg | 1060.06 Pln | |
| Fluorochem | 500mg | 1632.78 Pln | |
| Fluorochem | 1g | 2080.54 Pln | |
| Fluorochem | 2.5g | 2825.06 Pln |
properties
| purity | 97% |
|---|---|
| delivery time | 3-4 weeks |
2-(3,5-difluorophenoxy)acetic acid (CAS 370-02-5) is a chemical compound with the molecular formula C8H6F2O3 and a molecular weight of 188.13 g/mol. IUPAC name: 2-(3,5-difluorophenoxy)acetic acid. InChIKey: DAKQOKIYIPBOHY-UHFFFAOYSA-N.
| Molecular formula | C8H6F2O3 |
|---|---|
| Molecular weight | 188.13 g/mol |
| IUPAC name | 2-(3,5-difluorophenoxy)acetic acid |
| InChIKey | DAKQOKIYIPBOHY-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C=C1F)F)OCC(=O)O |
Computed by PubChem (NCBI)