cas: 669713-75-1 — see every product listed under this CAS number, including other names
2-(3-(Benzo(d)(1,3)dioxol-5-yl)phenyl)acetic acid, 97% (CAS 669713-75-1) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g. Offered by: AmBeed.
| brand | AmBeed |
|---|---|
| catalog number | A649523-250mg |
| cas | 669713-75-1 |
| size | 250mg |
| availability | Synthetic Items: 0g |
| brand | size | price | |
|---|---|---|---|
| AmBeed | 250mg | 1957.90 Pln | |
| AmBeed | 1g | 6221.95 Pln |
| purity | 97% |
|---|---|
| delivery time | To be confirmed by Chemat |
2-[3-(1,3-benzodioxol-5-yl)phenyl]acetic acid (CAS 669713-75-1) is a chemical compound with the molecular formula C15H12O4 and a molecular weight of 256.25 g/mol. IUPAC name: 2-[3-(1,3-benzodioxol-5-yl)phenyl]acetic acid. InChIKey: HDZYSLBSWPPUJY-UHFFFAOYSA-N.
| Molecular formula | C15H12O4 |
|---|---|
| Molecular weight | 256.25 g/mol |
| IUPAC name | 2-[3-(1,3-benzodioxol-5-yl)phenyl]acetic acid |
| InChIKey | HDZYSLBSWPPUJY-UHFFFAOYSA-N |
| SMILES | C1OC2=C(O1)C=C(C=C2)C3=CC=CC(=C3)CC(=O)O |
Computed by PubChem (NCBI)