CAS 68745-38-0 appears in our catalog under these names: Pinocembrin, 95%, rac-Pinocembrin, rac-Pinocembrin, >95% (HPLC), Pinocembrin, (+/-)-Pinocembrin/ 99.79% (existing batch purity). Offered by: Combi-blocks, Chemat Brand, TRC, Dr. Ehrenstorfer, TargetMol. Available pack sizes: 100mg, 250mg, on request, 2,5g, 5g, 25mg, 1mg, 5mg.
5,7-dihydroxy-2-phenyl-2,3-dihydrochromen-4-one (CAS 68745-38-0) is a chemical compound with the molecular formula C15H12O4 and a molecular weight of 256.25 g/mol. IUPAC name: 5,7-dihydroxy-2-phenyl-2,3-dihydrochromen-4-one. InChIKey: URFCJEUYXNAHFI-UHFFFAOYSA-N.
| Molecular formula | C15H12O4 |
|---|---|
| Molecular weight | 256.25 g/mol |
| IUPAC name | 5,7-dihydroxy-2-phenyl-2,3-dihydrochromen-4-one |
| InChIKey | URFCJEUYXNAHFI-UHFFFAOYSA-N |
| SMILES | C1C(OC2=CC(=CC(=C2C1=O)O)O)C3=CC=CC=C3 |
Computed by PubChem (NCBI)