cas: 914397-60-7 — see every product listed under this CAS number, including other names
2-(3-Boronophenyl)acetic acid, 98% (CAS 914397-60-7) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F215879-250MG |
| cas | 914397-60-7 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 250mg | 476.93 Pln | |
| Fluorochem | 1g | 1153.78 Pln | |
| Fluorochem | 5g | 3949.67 Pln | |
| Fluorochem | 10g | 6662.26 Pln |
| purity | 98% |
|---|---|
| delivery time | 3-4 weeks |
2-(3-boronophenyl)acetic acid (CAS 914397-60-7) is a chemical compound with the molecular formula C8H9BO4 and a molecular weight of 179.97 g/mol. IUPAC name: 2-(3-boronophenyl)acetic acid. InChIKey: UQOJWKCPHDCNQS-UHFFFAOYSA-N.
| Molecular formula | C8H9BO4 |
|---|---|
| Molecular weight | 179.97 g/mol |
| IUPAC name | 2-(3-boronophenyl)acetic acid |
| InChIKey | UQOJWKCPHDCNQS-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=CC=C1)CC(=O)O)(O)O |
Computed by PubChem (NCBI)