cas: 20389-10-0 — see every product listed under this CAS number, including other names
2-(3-Chlorophenyl)quinoline-4-carboxylic acid, 96% (CAS 20389-10-0) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F014401-250MG |
| cas | 20389-10-0 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 250mg | 341.56 Pln | |
| Fluorochem | 1g | 622.72 Pln | |
| Fluorochem | 5g | 1762.94 Pln | |
| Fluorochem | 10g | 2689.70 Pln |
| purity | 96% |
|---|---|
| delivery time | 3-4 weeks |
2-(3-chlorophenyl)quinoline-4-carboxylic acid (CAS 20389-10-0) is a chemical compound with the molecular formula C16H10ClNO2 and a molecular weight of 283.71 g/mol. IUPAC name: 2-(3-chlorophenyl)quinoline-4-carboxylic acid. InChIKey: QPDXYIKQOBZSGQ-UHFFFAOYSA-N.
| Molecular formula | C16H10ClNO2 |
|---|---|
| Molecular weight | 283.71 g/mol |
| IUPAC name | 2-(3-chlorophenyl)quinoline-4-carboxylic acid |
| InChIKey | QPDXYIKQOBZSGQ-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(=CC(=N2)C3=CC(=CC=C3)Cl)C(=O)O |
Computed by PubChem (NCBI)