Products 4560-08-1
CAS 4560-08-1 appears in our catalog under these names: TSPO ligand-1, 98.0%, TSPO ligand-1, 98%, 2-oxo-2-(2-phenyl-1H-indol-3-yl)acetyl chloride. Offered by: MedChemExpress, Ambeed, Chemat. Available pack sizes: 25 mg, 10 mg, 5 mg, 100 mg, 50 mg, 100mg, 250mg, 1g.
2-oxo-2-(2-phenyl-1H-indol-3-yl)acetyl chloride (CAS 4560-08-1) is a chemical compound with the molecular formula C16H10ClNO2 and a molecular weight of 283.71 g/mol. IUPAC name: 2-oxo-2-(2-phenyl-1H-indol-3-yl)acetyl chloride. InChIKey: DREHVYWKTXGDBS-UHFFFAOYSA-N.
| Molecular formula | C16H10ClNO2 |
|---|---|
| Molecular weight | 283.71 g/mol |
| IUPAC name | 2-oxo-2-(2-phenyl-1H-indol-3-yl)acetyl chloride |
| InChIKey | DREHVYWKTXGDBS-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=C(C3=CC=CC=C3N2)C(=O)C(=O)Cl |
Computed by PubChem (NCBI)