2-(3-Methoxyphenoxy)aniline hydrochloride, 97%
cas: 1185078-17-4 — see every product listed under this CAS number, including other names
2-(3-Methoxyphenoxy)aniline hydrochloride, 97% (CAS 1185078-17-4) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Ambeed, Chemat, BLDpharm.
| brand | Ambeed |
|---|---|
| catalog number | A523473-100mg |
| cas | 1185078-17-4 |
| size | 100mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 375.94 Pln | |
| Ambeed | 250mg | 587.31 Pln | |
| Ambeed | 1g | 1466.19 Pln | |
| Ambeed | 5g | 4253.00 Pln | |
| Chemat | 100mg | 347.60 Pln | |
| Chemat | 250mg | 539.60 Pln | |
| Chemat | 1g | 1355.60 Pln | |
| BLDpharm | 100mg | 369.89 Pln | |
| BLDpharm | 250mg | 575.38 Pln | |
| BLDpharm | 1g | 1441.74 Pln | |
| BLDpharm | 5g | 4174.11 Pln |
properties
| purity | 97% |
|---|---|
| delivery time | 2-3 weeks |
2-(3-methoxyphenoxy)aniline;hydrochloride (CAS 1185078-17-4) is a chemical compound with the molecular formula C13H14ClNO2 and a molecular weight of 251.71 g/mol. IUPAC name: 2-(3-methoxyphenoxy)aniline;hydrochloride. InChIKey: IAPQPARNGRBBDB-UHFFFAOYSA-N.
| Molecular formula | C13H14ClNO2 |
|---|---|
| Molecular weight | 251.71 g/mol |
| IUPAC name | 2-(3-methoxyphenoxy)aniline;hydrochloride |
| InChIKey | IAPQPARNGRBBDB-UHFFFAOYSA-N |
| SMILES | COC1=CC(=CC=C1)OC2=CC=CC=C2N.Cl |
Computed by PubChem (NCBI)