Products 943825-15-8

CAS 943825-15-8 appears in our catalog under these names: (2,4-Dimethylquinolin-3-yl)acetic acid hydrochloride, 95%, 2-(2,4-Dimethylquinolin-3-yl)acetic acid hydrochloride, 95%, 2-(2,4-Dimethylquinolin-3-yl)acetic acid hydrochloride 95%, 2-(2,4-Dimethylquinolin-3-yl)acetic acid hydrochloride, 95%, 95%. Offered by: Combi-blocks, AmBeed, Chemat, Fluorochem. Available pack sizes: 5g, 250mg, 1g, 100mg.

Structural formula: {0} (CAS {1})

2-(2,4-dimethylquinolin-3-yl)acetic acid;hydrochloride (CAS 943825-15-8) is a chemical compound with the molecular formula C13H14ClNO2 and a molecular weight of 251.71 g/mol. IUPAC name: 2-(2,4-dimethylquinolin-3-yl)acetic acid;hydrochloride. InChIKey: BJAKLXOGLLFBJM-UHFFFAOYSA-N.

Identity
Molecular formulaC13H14ClNO2
Molecular weight251.71 g/mol
IUPAC name2-(2,4-dimethylquinolin-3-yl)acetic acid;hydrochloride
InChIKeyBJAKLXOGLLFBJM-UHFFFAOYSA-N
SMILESCC1=C(C(=NC2=CC=CC=C12)C)CC(=O)O.Cl

Computed by PubChem (NCBI)