CAS 1881293-06-6 is the registry number for tert-butyl 2-chloro-1H-indole-1-carboxylate, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
Tert-butyl 2-chloroindole-1-carboxylate (CAS 1881293-06-6) is a chemical compound with the molecular formula C13H14ClNO2 and a molecular weight of 251.71 g/mol. IUPAC name: tert-butyl 2-chloroindole-1-carboxylate. InChIKey: BJDRCNSFUBGUBD-UHFFFAOYSA-N.
| Molecular formula | C13H14ClNO2 |
|---|---|
| Molecular weight | 251.71 g/mol |
| IUPAC name | tert-butyl 2-chloroindole-1-carboxylate |
| InChIKey | BJDRCNSFUBGUBD-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1C2=CC=CC=C2C=C1Cl |
Computed by PubChem (NCBI)