CAS 122745-12-4 appears in our catalog under these names: 3-(2-Naphthyl)-l-alanine hydrochloride, 98%, (S)-2-Amino-3-(naphthalen-2-yl)propanoic acid hydrochloride, 95%, (S)–2–Amino–3–(naphthalen–2–yl)propanoic acid hydrochloride, 3-(2-Naphthyl)-L-alanine Hydrochloride, >98.0%(HPLC)(T), (S)-2-Amino-3-(naphthalen-2-yl)propanoic acid hydrochloride. Offered by: Combi-blocks, AmBeed, GLPBio, TCI, Biosynth. Available pack sizes: 1g, 5g, 250mg, 10g, 100g, 25g.
(2S)-2-amino-3-naphthalen-2-ylpropanoic acid;hydrochloride (CAS 122745-12-4) is a chemical compound with the molecular formula C13H14ClNO2 and a molecular weight of 251.71 g/mol. IUPAC name: (2S)-2-amino-3-naphthalen-2-ylpropanoic acid;hydrochloride. InChIKey: QXEYSNIVQNSZGX-YDALLXLXSA-N.
| Molecular formula | C13H14ClNO2 |
|---|---|
| Molecular weight | 251.71 g/mol |
| IUPAC name | (2S)-2-amino-3-naphthalen-2-ylpropanoic acid;hydrochloride |
| InChIKey | QXEYSNIVQNSZGX-YDALLXLXSA-N |
| SMILES | C1=CC=C2C=C(C=CC2=C1)C[C@@H](C(=O)O)N.Cl |
Computed by PubChem (NCBI)