CAS 179811-51-9 appears in our catalog under these names: Methyl amino(2-naphthyl)acetate hydrochloride, 95%, Methyl 2-amino-2-(naphthalen-2-yl)acetate hcl, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 250mg, 1g.
Methyl 2-amino-2-naphthalen-2-ylacetate;hydrochloride (CAS 179811-51-9) is a chemical compound with the molecular formula C13H14ClNO2 and a molecular weight of 251.71 g/mol. IUPAC name: methyl 2-amino-2-naphthalen-2-ylacetate;hydrochloride. InChIKey: GIDMDKRCSDIXST-UHFFFAOYSA-N.
| Molecular formula | C13H14ClNO2 |
|---|---|
| Molecular weight | 251.71 g/mol |
| IUPAC name | methyl 2-amino-2-naphthalen-2-ylacetate;hydrochloride |
| InChIKey | GIDMDKRCSDIXST-UHFFFAOYSA-N |
| SMILES | COC(=O)C(C1=CC2=CC=CC=C2C=C1)N.Cl |
Computed by PubChem (NCBI)