CAS 122745-10-2 appears in our catalog under these names: 3-(1-Naphthyl)-l-alanine hydrochloride, 95%, (S)–2–Amino–3–(naphthalen–1–yl)propanoic acid hydrochloride, 3-(1-Naphthyl)-L-alanine Hydrochloride, >97.0%(HPLC)(T), 3-(1-Naphthyl)-l-alanine HCl, 97%, 97%, (S)-2-Amino-3-(naphthalen-1-yl)propanoic acid hydrochloride, 97%. Offered by: Combi-blocks, GLPBio, TCI, Chemat, Fluorochem. Available pack sizes: 250mg, 5g, 1g.
(2S)-2-amino-3-naphthalen-1-ylpropanoic acid;hydrochloride (CAS 122745-10-2) is a chemical compound with the molecular formula C13H14ClNO2 and a molecular weight of 251.71 g/mol. IUPAC name: (2S)-2-amino-3-naphthalen-1-ylpropanoic acid;hydrochloride. InChIKey: BKQQPCDQZZTLSE-YDALLXLXSA-N.
| Molecular formula | C13H14ClNO2 |
|---|---|
| Molecular weight | 251.71 g/mol |
| IUPAC name | (2S)-2-amino-3-naphthalen-1-ylpropanoic acid;hydrochloride |
| InChIKey | BKQQPCDQZZTLSE-YDALLXLXSA-N |
| SMILES | C1=CC=C2C(=C1)C=CC=C2C[C@@H](C(=O)O)N.Cl |
Computed by PubChem (NCBI)