CAS 129822-46-4 appears in our catalog under these names: 1-BOC-4-Chloroindole, 98%, 1-Boc-4-Chloroindole, 98%, 98%, tert-Butyl 4-chloro-1H-indole-1-carboxylate 98%. Offered by: Combi-blocks, Fluorochem, Chemat, Ambeed. Available pack sizes: 25g, 5g, 1g, 250mg, 100mg.
Tert-butyl 4-chloroindole-1-carboxylate (CAS 129822-46-4) is a chemical compound with the molecular formula C13H14ClNO2 and a molecular weight of 251.71 g/mol. IUPAC name: tert-butyl 4-chloroindole-1-carboxylate. InChIKey: SNYOMIGRAXEOBR-UHFFFAOYSA-N.
| Molecular formula | C13H14ClNO2 |
|---|---|
| Molecular weight | 251.71 g/mol |
| IUPAC name | tert-butyl 4-chloroindole-1-carboxylate |
| InChIKey | SNYOMIGRAXEOBR-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1C=CC2=C1C=CC=C2Cl |
Computed by PubChem (NCBI)